About 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile
4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile (PubChem CID 67688408) has the molecular formula C12H7F3N4O3
and a molecular weight of 312.21 g/mol. Its IUPAC name is 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile.
Molecular Properties
| Compound Name | 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile |
| PubChem CID | 67688408 |
| Molecular Formula | C12H7F3N4O3 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile |
| SMILES | N#Cc1ccc(-n2c(=O)[nH]c(C(F)(F)F)c(N)c2=O)cc1O |
| InChI | InChI=1S/C12H7F3N4O3/c13-12(14,15)9-8(17)10(21)19(11(22)18-9)6-2-1-5(4-16)7(20)3-6/h1-3,20H,17H2,(H,18,22) |
| InChIKey | PLVPWICNOKALHS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile?
The IUPAC name of 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile (CID 67688408) is 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile.
What is the SMILES notation for 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile?
The canonical SMILES for 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile is N#Cc1ccc(-n2c(=O)[nH]c(C(F)(F)F)c(N)c2=O)cc1O.
What is the InChIKey of 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile?
The InChIKey is PLVPWICNOKALHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F3N4O3/c13-12(14,15)9-8(17)10(21)19(11(22)18-9)6-2-1-5(4-16)7(20)3-6/h1-3,20H,17H2,(H,18,22).
What are the key properties of 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile?
4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile has a molecular weight of 312.21 g/mol, XLogP of 0.70, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-amino-2,4-dioxo-6-(trifluoromethyl)-1H-pyrimidin-3-yl]-2-hydroxybenzonitrile is sourced from PubChem (CID 67688408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).