C26H22F2N2O3 — CID 67688493
1'-[(2,4-difluorophenyl)methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 67688493) has the molecular formula C26H22F2N2O3 and a molecular weight of 448.47 g/mol. Its IUPAC name is 1'-[(2,4-difluorophenyl)methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 1'-[(2,4-difluorophenyl)methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 67688493 |
| Molecular Formula | C26H22F2N2O3 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1'-[(2,4-difluorophenyl)methyl]-3',3',8-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | Cc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(Cc2ccc(F)cc2F)c2ccccc2C1(C)C |
| InChI | InChI=1S/C26H22F2N2O3/c1-16-12-20(30(31)32)13-17-10-11-26(33-24(16)17)25(2,3)21-6-4-5-7-23(21)29(26)15-18-8-9-19(27)14-22(18)28/h4-14H,15H2,1-3H3 |
| InChIKey | NNHXJDHZQSJYDN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|