About 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran
2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran (PubChem CID 67688665) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran.
Molecular Properties
| Compound Name | 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran |
| PubChem CID | 67688665 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran |
| SMILES | C1=COC(OC=CC2=CCCC=C2)C=C1 |
| InChI | InChI=1S/C13H14O2/c1-2-6-12(7-3-1)9-11-15-13-8-4-5-10-14-13/h2,4-11,13H,1,3H2 |
| InChIKey | ANPICHHWJKCWLJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran?
The IUPAC name of 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran (CID 67688665) is 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran.
What is the SMILES notation for 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran?
The canonical SMILES for 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran is C1=COC(OC=CC2=CCCC=C2)C=C1.
What is the InChIKey of 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran?
The InChIKey is ANPICHHWJKCWLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c1-2-6-12(7-3-1)9-11-15-13-8-4-5-10-14-13/h2,4-11,13H,1,3H2.
What are the key properties of 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran?
2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran has a molecular weight of 202.25 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclohexa-1,5-dien-1-ylethenoxy)-2H-pyran is sourced from PubChem (CID 67688665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).