C36H74O5Si — CID 67689097
2,2,6,6-tetrakis(2-ethylhexoxy)oxasilinane (PubChem CID 67689097) has the molecular formula C36H74O5Si and a molecular weight of 615.07 g/mol. Its IUPAC name is 2,2,6,6-tetrakis(2-ethylhexoxy)oxasilinane.
| Compound Name | 2,2,6,6-tetrakis(2-ethylhexoxy)oxasilinane |
|---|---|
| PubChem CID | 67689097 |
| Molecular Formula | C36H74O5Si |
| Molecular Weight | 615.07 g/mol |
| Exact Mass | 614.53 |
| IUPAC Name | 2,2,6,6-tetrakis(2-ethylhexoxy)oxasilinane |
| SMILES | CCCCC(CC)COC1(OCC(CC)CCCC)CCC[Si](OCC(CC)CCCC)(OCC(CC)CCCC)O1 |
| InChI | InChI=1S/C36H74O5Si/c1-9-17-22-32(13-5)28-37-36(38-29-33(14-6)23-18-10-2)26-21-27-42(41-36,39-30-34(15-7)24-19-11-3)40-31-35(16-8)25-20-12-4/h32-35H,9-31H2,1-8H3 |
| InChIKey | XJQCEIWSYHAULX-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.07 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|