C18H28ClNO2 — CID 67689250
(4bS,8aR)-4b-[2-(ethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthrene-3,8a-diol;hydrochloride (PubChem CID 67689250) has the molecular formula C18H28ClNO2 and a molecular weight of 325.88 g/mol. Its IUPAC name is (4bS,8aR)-4b-[2-(ethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthrene-3,8a-diol;hydrochloride.
| Compound Name | (4bS,8aR)-4b-[2-(ethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthrene-3,8a-diol;hydrochloride |
|---|---|
| PubChem CID | 67689250 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (4bS,8aR)-4b-[2-(ethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthrene-3,8a-diol;hydrochloride |
| SMILES | CCNCC[C@]12CCCC[C@@]1(O)CCc1ccc(O)cc12.Cl |
| InChI | InChI=1S/C18H27NO2.ClH/c1-2-19-12-11-17-8-3-4-9-18(17,21)10-7-14-5-6-15(20)13-16(14)17;/h5-6,13,19-21H,2-4,7-12H2,1H3;1H/t17-,18+;/m0./s1 |
| InChIKey | BTEHKVIGVXPZCN-CJRXIRLBSA-N |
| XLogP | 3.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|