C16H23Cl2NO — CID 67689306
(4bS,8aR)-4b-(2-aminoethyl)-3-chloro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol;hydrochloride (PubChem CID 67689306) has the molecular formula C16H23Cl2NO and a molecular weight of 316.27 g/mol. Its IUPAC name is (4bS,8aR)-4b-(2-aminoethyl)-3-chloro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol;hydrochloride.
| Compound Name | (4bS,8aR)-4b-(2-aminoethyl)-3-chloro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol;hydrochloride |
|---|---|
| PubChem CID | 67689306 |
| Molecular Formula | C16H23Cl2NO |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (4bS,8aR)-4b-(2-aminoethyl)-3-chloro-5,6,7,8,9,10-hexahydrophenanthren-8a-ol;hydrochloride |
| SMILES | Cl.NCC[C@]12CCCC[C@@]1(O)CCc1ccc(Cl)cc12 |
| InChI | InChI=1S/C16H22ClNO.ClH/c17-13-4-3-12-5-8-16(19)7-2-1-6-15(16,9-10-18)14(12)11-13;/h3-4,11,19H,1-2,5-10,18H2;1H/t15-,16+;/m0./s1 |
| InChIKey | OYIPWSSLHZNEHY-IDVLALEDSA-N |
| XLogP | 3.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |