C17H24N4O3 — CID 67689740
6-[2-[2-(4-aminophenoxy)ethyl-methylamino]ethyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 67689740) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 6-[2-[2-(4-aminophenoxy)ethyl-methylamino]ethyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[2-[2-(4-aminophenoxy)ethyl-methylamino]ethyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67689740 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 6-[2-[2-(4-aminophenoxy)ethyl-methylamino]ethyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CN(CCOc1ccc(N)cc1)CCc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C17H24N4O3/c1-19(10-11-24-15-6-4-13(18)5-7-15)9-8-14-12-16(22)21(3)17(23)20(14)2/h4-7,12H,8-11,18H2,1-3H3 |
| InChIKey | WKGMNYQVNVEXOB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|