C13H19N3O5 — CID 67690651
(4-butoxy-3-methoxy-2-pyridinyl) N-(2-aminoacetyl)carbamate (PubChem CID 67690651) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is (4-butoxy-3-methoxy-2-pyridinyl) N-(2-aminoacetyl)carbamate.
| Compound Name | (4-butoxy-3-methoxy-2-pyridinyl) N-(2-aminoacetyl)carbamate |
|---|---|
| PubChem CID | 67690651 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (4-butoxy-3-methoxy-2-pyridinyl) N-(2-aminoacetyl)carbamate |
| SMILES | CCCCOc1ccnc(OC(=O)NC(=O)CN)c1OC |
| InChI | InChI=1S/C13H19N3O5/c1-3-4-7-20-9-5-6-15-12(11(9)19-2)21-13(18)16-10(17)8-14/h5-6H,3-4,7-8,14H2,1-2H3,(H,16,17,18) |
| InChIKey | UWZNPUSLRWJVAX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|