C22H26Cl3N3O3 — CID 67690698
(2R,4S)-4-[[2-[4-(4-aminobutyl)phenyl]acetyl]amino]-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride (PubChem CID 67690698) has the molecular formula C22H26Cl3N3O3 and a molecular weight of 486.83 g/mol. Its IUPAC name is (2R,4S)-4-[[2-[4-(4-aminobutyl)phenyl]acetyl]amino]-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride.
| Compound Name | (2R,4S)-4-[[2-[4-(4-aminobutyl)phenyl]acetyl]amino]-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 67690698 |
| Molecular Formula | C22H26Cl3N3O3 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | (2R,4S)-4-[[2-[4-(4-aminobutyl)phenyl]acetyl]amino]-5,7-dichloro-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride |
| SMILES | Cl.NCCCCc1ccc(CC(=O)N[C@H]2C[C@H](C(=O)O)Nc3cc(Cl)cc(Cl)c32)cc1 |
| InChI | InChI=1S/C22H25Cl2N3O3.ClH/c23-15-10-16(24)21-17(11-15)26-19(22(29)30)12-18(21)27-20(28)9-14-6-4-13(5-7-14)3-1-2-8-25;/h4-7,10-11,18-19,26H,1-3,8-9,12,25H2,(H,27,28)(H,29,30);1H/t18-,19+;/m0./s1 |
| InChIKey | YUIMUJHFGIMBFK-GRTNUQQKSA-N |
| XLogP | 4.37 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|