C17H19N3O6 — CID 67691059
[3-methoxy-4-[(3-methoxyphenyl)methoxy]-2-pyridinyl] N-(2-aminoacetyl)carbamate (PubChem CID 67691059) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is [3-methoxy-4-[(3-methoxyphenyl)methoxy]-2-pyridinyl] N-(2-aminoacetyl)carbamate.
| Compound Name | [3-methoxy-4-[(3-methoxyphenyl)methoxy]-2-pyridinyl] N-(2-aminoacetyl)carbamate |
|---|---|
| PubChem CID | 67691059 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [3-methoxy-4-[(3-methoxyphenyl)methoxy]-2-pyridinyl] N-(2-aminoacetyl)carbamate |
| SMILES | COc1cccc(COc2ccnc(OC(=O)NC(=O)CN)c2OC)c1 |
| InChI | InChI=1S/C17H19N3O6/c1-23-12-5-3-4-11(8-12)10-25-13-6-7-19-16(15(13)24-2)26-17(22)20-14(21)9-18/h3-8H,9-10,18H2,1-2H3,(H,20,21,22) |
| InChIKey | HDCZKWYGKPBGCY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |