C26H41NO5Si — CID 67691560
(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1R,3R)-2-oxo-3-(2-phenylmethoxyethoxy)cyclohexyl]azetidin-2-one (PubChem CID 67691560) has the molecular formula C26H41NO5Si and a molecular weight of 475.70 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1R,3R)-2-oxo-3-(2-phenylmethoxyethoxy)cyclohexyl]azetidin-2-one.
| Compound Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1R,3R)-2-oxo-3-(2-phenylmethoxyethoxy)cyclohexyl]azetidin-2-one |
|---|---|
| PubChem CID | 67691560 |
| Molecular Formula | C26H41NO5Si |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(1R,3R)-2-oxo-3-(2-phenylmethoxyethoxy)cyclohexyl]azetidin-2-one |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1[C@H]1CCC[C@@H](OCCOCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H41NO5Si/c1-18(32-33(5,6)26(2,3)4)22-23(27-25(22)29)20-13-10-14-21(24(20)28)31-16-15-30-17-19-11-8-7-9-12-19/h7-9,11-12,18,20-23H,10,13-17H2,1-6H3,(H,27,29)/t18-,20-,21-,22-,23-/m1/s1 |
| InChIKey | LLCRTSAVWJDEPG-OKKOYFSCSA-N |
| XLogP | 4.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|