C25H27ClN2O8S — CID 67691642
but-2-enedioic acid;3-[1-(4-chlorophenyl)-3-morpholin-4-ylpropyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one (PubChem CID 67691642) has the molecular formula C25H27ClN2O8S and a molecular weight of 551.02 g/mol. Its IUPAC name is but-2-enedioic acid;3-[1-(4-chlorophenyl)-3-morpholin-4-ylpropyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one.
| Compound Name | but-2-enedioic acid;3-[1-(4-chlorophenyl)-3-morpholin-4-ylpropyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 67691642 |
| Molecular Formula | C25H27ClN2O8S |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | but-2-enedioic acid;3-[1-(4-chlorophenyl)-3-morpholin-4-ylpropyl]-2,2-dioxo-1H-2λ6,3-benzothiazin-4-one |
| SMILES | O=C(O)C=CC(=O)O.O=C1c2ccccc2CS(=O)(=O)N1C(CCN1CCOCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClN2O4S.C4H4O4/c22-18-7-5-16(6-8-18)20(9-10-23-11-13-28-14-12-23)24-21(25)19-4-2-1-3-17(19)15-29(24,26)27;5-3(6)1-2-4(7)8/h1-8,20H,9-15H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | NIIKGVQFJHNTCA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|