C26H56N6 — CID 67692079
N'-[2-[2-[bis(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethylamino]ethyl]ethane-1,2-diamine (PubChem CID 67692079) has the molecular formula C26H56N6 and a molecular weight of 452.78 g/mol. Its IUPAC name is N'-[2-[2-[bis(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-[bis(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 67692079 |
| Molecular Formula | C26H56N6 |
| Molecular Weight | 452.78 g/mol |
| Exact Mass | 452.46 |
| IUPAC Name | N'-[2-[2-[bis(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]ethylamino]ethyl]ethane-1,2-diamine |
| SMILES | CN1C(C)(C)CC(N(CCNCCNCCN)C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C26H56N6/c1-23(2)17-21(18-24(3,4)30(23)9)32(16-15-29-14-13-28-12-11-27)22-19-25(5,6)31(10)26(7,8)20-22/h21-22,28-29H,11-20,27H2,1-10H3 |
| InChIKey | AMHVARNTDABQLS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.78 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|