About cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride
cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (PubChem CID 67692396) has the molecular formula C11H22ClNO2S
and a molecular weight of 267.82 g/mol. Its IUPAC name is cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
Molecular Properties
| Compound Name | cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| PubChem CID | 67692396 |
| Molecular Formula | C11H22ClNO2S |
| Molecular Weight | 267.82 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)OC1CCCCC1.Cl |
| InChI | InChI=1S/C11H21NO2S.ClH/c1-15-8-7-10(12)11(13)14-9-5-3-2-4-6-9;/h9-10H,2-8,12H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | BYQGPJHXURXZBP-PPHPATTJSA-N |
| XLogP | 2.36 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The IUPAC name of cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride (CID 67692396) is cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride.
What is the SMILES notation for cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The canonical SMILES for cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is CSCC[C@H](N)C(=O)OC1CCCCC1.Cl.
What is the InChIKey of cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
The InChIKey is BYQGPJHXURXZBP-PPHPATTJSA-N. The full InChI is InChI=1S/C11H21NO2S.ClH/c1-15-8-7-10(12)11(13)14-9-5-3-2-4-6-9;/h9-10H,2-8,12H2,1H3;1H/t10-;/m0./s1.
What are the key properties of cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride?
cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride has a molecular weight of 267.82 g/mol, XLogP of 2.36, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl (2S)-2-amino-4-methylsulfanylbutanoate;hydrochloride is sourced from PubChem (CID 67692396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).