About CID 67692430
CID 67692430 (PubChem CID 67692430) has the molecular formula C27H39N2O5Si
and a molecular weight of 499.70 g/mol.
Molecular Properties
| Compound Name | CID 67692430 |
| PubChem CID | 67692430 |
| Molecular Formula | C27H39N2O5Si |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | — |
| SMILES | C[C@@H](C(=O)N1C(=O)c2ccccc2OC12CCCCC2)[C@H]1NC(=O)[C@@H]1[C@@](C)(O[Si](C)C)C(C)(C)C |
| InChI | InChI=1S/C27H39N2O5Si/c1-17(21-20(22(30)28-21)26(5,25(2,3)4)34-35(6)7)23(31)29-24(32)18-13-9-10-14-19(18)33-27(29)15-11-8-12-16-27/h9-10,13-14,17,20-21H,8,11-12,15-16H2,1-7H3,(H,28,30)/t17-,20-,21-,26-/m1/s1 |
| InChIKey | BYVQTTJPMQWWRQ-VLTRPUBQSA-N |
| XLogP | 4.53 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67692430 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67692430?
The IUPAC name of CID 67692430 (CID 67692430) is not available.
What is the SMILES notation for CID 67692430?
The canonical SMILES for CID 67692430 is C[C@@H](C(=O)N1C(=O)c2ccccc2OC12CCCCC2)[C@H]1NC(=O)[C@@H]1[C@@](C)(O[Si](C)C)C(C)(C)C.
What is the InChIKey of CID 67692430?
The InChIKey is BYVQTTJPMQWWRQ-VLTRPUBQSA-N. The full InChI is InChI=1S/C27H39N2O5Si/c1-17(21-20(22(30)28-21)26(5,25(2,3)4)34-35(6)7)23(31)29-24(32)18-13-9-10-14-19(18)33-27(29)15-11-8-12-16-27/h9-10,13-14,17,20-21H,8,11-12,15-16H2,1-7H3,(H,28,30)/t17-,20-,21-,26-/m1/s1.
What are the key properties of CID 67692430?
CID 67692430 has a molecular weight of 499.70 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67692430 is sourced from PubChem (CID 67692430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).