C18H25F3N2O — CID 67693709
(2R,3S)-3-amino-4-phenyl-1-[2-(trifluoromethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]butan-2-ol (PubChem CID 67693709) has the molecular formula C18H25F3N2O and a molecular weight of 342.41 g/mol. Its IUPAC name is (2R,3S)-3-amino-4-phenyl-1-[2-(trifluoromethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]butan-2-ol.
| Compound Name | (2R,3S)-3-amino-4-phenyl-1-[2-(trifluoromethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 67693709 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2R,3S)-3-amino-4-phenyl-1-[2-(trifluoromethyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]butan-2-ol |
| SMILES | N[C@@H](Cc1ccccc1)[C@H](O)CN1C2CCCC2CC1C(F)(F)F |
| InChI | InChI=1S/C18H25F3N2O/c19-18(20,21)17-10-13-7-4-8-15(13)23(17)11-16(24)14(22)9-12-5-2-1-3-6-12/h1-3,5-6,13-17,24H,4,7-11,22H2/t13?,14-,15?,16+,17?/m0/s1 |
| InChIKey | PODNAXDXGBBPCD-ZISAHBJPSA-N |
| XLogP | 2.72 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |