C8H13NO — CID 67693750
1-(1,2,3,4-tetrahydropyridin-2-yl)propan-2-one (PubChem CID 67693750) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydropyridin-2-yl)propan-2-one.
| Compound Name | 1-(1,2,3,4-tetrahydropyridin-2-yl)propan-2-one |
|---|---|
| PubChem CID | 67693750 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1-(1,2,3,4-tetrahydropyridin-2-yl)propan-2-one |
| SMILES | CC(=O)CC1CCC=CN1 |
| InChI | InChI=1S/C8H13NO/c1-7(10)6-8-4-2-3-5-9-8/h3,5,8-9H,2,4,6H2,1H3 |
| InChIKey | PRBVSOXWRAAWGD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |