C15H15NO — CID 67693913
(10aZ)-2,5,6a,12-tetrahydro-1H-benzo[c][1]benzazocin-6-one (PubChem CID 67693913) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is (10aZ)-2,5,6a,12-tetrahydro-1H-benzo[c][1]benzazocin-6-one.
| Compound Name | (10aZ)-2,5,6a,12-tetrahydro-1H-benzo[c][1]benzazocin-6-one |
|---|---|
| PubChem CID | 67693913 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (10aZ)-2,5,6a,12-tetrahydro-1H-benzo[c][1]benzazocin-6-one |
| SMILES | O=C1NC2=C(C/C=C3/C=CC=CC13)CCC=C2 |
| InChI | InChI=1S/C15H15NO/c17-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16-15/h1,3-5,7-9,13H,2,6,10H2,(H,16,17)/b11-9- |
| InChIKey | FWGGANCNJXLQSC-LUAWRHEFSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |