C32H38N2O4S — CID 67693964
7-[1-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,3-dihydroisoindol-2-yl]-2-(4-methylphenyl)sulfanylheptanenitrile (PubChem CID 67693964) has the molecular formula C32H38N2O4S and a molecular weight of 546.73 g/mol. Its IUPAC name is 7-[1-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,3-dihydroisoindol-2-yl]-2-(4-methylphenyl)sulfanylheptanenitrile.
| Compound Name | 7-[1-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,3-dihydroisoindol-2-yl]-2-(4-methylphenyl)sulfanylheptanenitrile |
|---|---|
| PubChem CID | 67693964 |
| Molecular Formula | C32H38N2O4S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 7-[1-(3,4-dimethoxyphenyl)-5,6-dimethoxy-1,3-dihydroisoindol-2-yl]-2-(4-methylphenyl)sulfanylheptanenitrile |
| SMILES | COc1ccc(C2c3cc(OC)c(OC)cc3CN2CCCCCC(C#N)Sc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C32H38N2O4S/c1-22-10-13-25(14-11-22)39-26(20-33)9-7-6-8-16-34-21-24-18-30(37-4)31(38-5)19-27(24)32(34)23-12-15-28(35-2)29(17-23)36-3/h10-15,17-19,26,32H,6-9,16,21H2,1-5H3 |
| InChIKey | KIDTVIMFQULIDY-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|