C17H28N2O3S2 — CID 67694119
(6S)-8-oxo-7-(pentylamino)-3-pentylsulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 67694119) has the molecular formula C17H28N2O3S2 and a molecular weight of 372.56 g/mol. Its IUPAC name is (6S)-8-oxo-7-(pentylamino)-3-pentylsulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-8-oxo-7-(pentylamino)-3-pentylsulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 67694119 |
| Molecular Formula | C17H28N2O3S2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (6S)-8-oxo-7-(pentylamino)-3-pentylsulfanyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCCCNC1C(=O)N2C(C(=O)O)=C(SCCCCC)CS[C@@H]12 |
| InChI | InChI=1S/C17H28N2O3S2/c1-3-5-7-9-18-13-15(20)19-14(17(21)22)12(11-24-16(13)19)23-10-8-6-4-2/h13,16,18H,3-11H2,1-2H3,(H,21,22)/t13?,16-/m0/s1 |
| InChIKey | GETNGMWOROHGJT-VYIIXAMBSA-N |
| XLogP | 3.27 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|