3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid

C7H9NO3 — CID 67694181

IUPAC3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid
SMILESNC1(O)C=C(C(=O)O)C=CC1
InChIInChI=1S/C7H9NO3/c8-7(11)3-1-2-5(4-7)6(9)10/h1-2,4,11H,3,8H2,(H,9,10)
InChIKeyLILNWBDFNQFSCI-UHFFFAOYSA-N
MW155.15 g/mol
LogP-0.40
Rot. Bonds1

About 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid

3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 67694181) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid.

Molecular Properties

Compound Name3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid
PubChem CID67694181
Molecular FormulaC7H9NO3
Molecular Weight155.15 g/mol
Exact Mass155.06
IUPAC Name3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid
SMILESNC1(O)C=C(C(=O)O)C=CC1
InChIInChI=1S/C7H9NO3/c8-7(11)3-1-2-5(4-7)6(9)10/h1-2,4,11H,3,8H2,(H,9,10)
InChIKeyLILNWBDFNQFSCI-UHFFFAOYSA-N
XLogP-0.40
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.15
LogP ≤ 5-0.40
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid (CID 67694181) is 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid is NC1(O)C=C(C(=O)O)C=CC1.
What is the InChIKey of 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is LILNWBDFNQFSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c8-7(11)3-1-2-5(4-7)6(9)10/h1-2,4,11H,3,8H2,(H,9,10).
What are the key properties of 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid?
3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 155.15 g/mol, XLogP of -0.40, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-hydroxycyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 67694181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).