C21H17N3O5S — CID 67694284
3-[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]ethyl]-4-oxo-2H-1,3-benzoxazine-6-carbonitrile (PubChem CID 67694284) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is 3-[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]ethyl]-4-oxo-2H-1,3-benzoxazine-6-carbonitrile.
| Compound Name | 3-[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]ethyl]-4-oxo-2H-1,3-benzoxazine-6-carbonitrile |
|---|---|
| PubChem CID | 67694284 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 3-[2-[4-[(2,5-dioxo-1,3-thiazolidin-4-yl)methyl]phenoxy]ethyl]-4-oxo-2H-1,3-benzoxazine-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C(=O)N(CCOc1ccc(CC3NC(=O)SC3=O)cc1)CO2 |
| InChI | InChI=1S/C21H17N3O5S/c22-11-14-3-6-18-16(9-14)19(25)24(12-29-18)7-8-28-15-4-1-13(2-5-15)10-17-20(26)30-21(27)23-17/h1-6,9,17H,7-8,10,12H2,(H,23,27) |
| InChIKey | BZCSYFMQQOSNMI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|