C20H17FN2O5S — CID 67694319
4-[[4-[2-(6-fluoro-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 67694319) has the molecular formula C20H17FN2O5S and a molecular weight of 416.43 g/mol. Its IUPAC name is 4-[[4-[2-(6-fluoro-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[2-(6-fluoro-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67694319 |
| Molecular Formula | C20H17FN2O5S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 4-[[4-[2-(6-fluoro-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1NC(Cc2ccc(OCCN3COc4ccc(F)cc4C3=O)cc2)C(=O)S1 |
| InChI | InChI=1S/C20H17FN2O5S/c21-13-3-6-17-15(10-13)18(24)23(11-28-17)7-8-27-14-4-1-12(2-5-14)9-16-19(25)29-20(26)22-16/h1-6,10,16H,7-9,11H2,(H,22,26) |
| InChIKey | LYDHSGRKTVOFJJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|