C20H18N2O7S — CID 67694374
4-[[4-[2-(6,7-dihydroxy-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 67694374) has the molecular formula C20H18N2O7S and a molecular weight of 430.44 g/mol. Its IUPAC name is 4-[[4-[2-(6,7-dihydroxy-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[4-[2-(6,7-dihydroxy-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67694374 |
| Molecular Formula | C20H18N2O7S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 4-[[4-[2-(6,7-dihydroxy-4-oxo-2H-1,3-benzoxazin-3-yl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1NC(Cc2ccc(OCCN3COc4cc(O)c(O)cc4C3=O)cc2)C(=O)S1 |
| InChI | InChI=1S/C20H18N2O7S/c23-15-8-13-17(9-16(15)24)29-10-22(18(13)25)5-6-28-12-3-1-11(2-4-12)7-14-19(26)30-20(27)21-14/h1-4,8-9,14,23-24H,5-7,10H2,(H,21,27) |
| InChIKey | QJGPRTVPNINCON-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|