C21H37NO7S — CID 67694392
4-O-tert-butyl 1-O,1-O-diethyl 4-amino-1-(oxan-4-ylmethylsulfanyl)butane-1,1,4-tricarboxylate (PubChem CID 67694392) has the molecular formula C21H37NO7S and a molecular weight of 447.59 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O,1-O-diethyl 4-amino-1-(oxan-4-ylmethylsulfanyl)butane-1,1,4-tricarboxylate.
| Compound Name | 4-O-tert-butyl 1-O,1-O-diethyl 4-amino-1-(oxan-4-ylmethylsulfanyl)butane-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 67694392 |
| Molecular Formula | C21H37NO7S |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 4-O-tert-butyl 1-O,1-O-diethyl 4-amino-1-(oxan-4-ylmethylsulfanyl)butane-1,1,4-tricarboxylate |
| SMILES | CCOC(=O)C(CCC(N)C(=O)OC(C)(C)C)(SCC1CCOCC1)C(=O)OCC |
| InChI | InChI=1S/C21H37NO7S/c1-6-27-18(24)21(19(25)28-7-2,30-14-15-9-12-26-13-10-15)11-8-16(22)17(23)29-20(3,4)5/h15-16H,6-14,22H2,1-5H3 |
| InChIKey | HJBVDFJSCOWVQD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|