About 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one
12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one (PubChem CID 67694417) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one.
Molecular Properties
| Compound Name | 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one |
| PubChem CID | 67694417 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one |
| SMILES | O=C1C=CC2(C=C1)CC1(CCC1)O2 |
| InChI | InChI=1S/C11H12O2/c12-9-2-6-11(7-3-9)8-10(13-11)4-1-5-10/h2-3,6-7H,1,4-5,8H2 |
| InChIKey | HHBGSCABSPUXMR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one?
The IUPAC name of 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one (CID 67694417) is 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one.
What is the SMILES notation for 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one?
The canonical SMILES for 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one is O=C1C=CC2(C=C1)CC1(CCC1)O2.
What is the InChIKey of 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one?
The InChIKey is HHBGSCABSPUXMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c12-9-2-6-11(7-3-9)8-10(13-11)4-1-5-10/h2-3,6-7H,1,4-5,8H2.
What are the key properties of 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one?
12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one has a molecular weight of 176.22 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-oxadispiro[3.1.56.14]dodeca-7,10-dien-9-one is sourced from PubChem (CID 67694417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).