C21H26ClNO2S — CID 67694454
3-but-1-enyl-3-ethyl-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide;hydrochloride (PubChem CID 67694454) has the molecular formula C21H26ClNO2S and a molecular weight of 391.96 g/mol. Its IUPAC name is 3-but-1-enyl-3-ethyl-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide;hydrochloride.
| Compound Name | 3-but-1-enyl-3-ethyl-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide;hydrochloride |
|---|---|
| PubChem CID | 67694454 |
| Molecular Formula | C21H26ClNO2S |
| Molecular Weight | 391.96 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-but-1-enyl-3-ethyl-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide;hydrochloride |
| SMILES | CCC=CC1(CC)CS(=O)(=O)c2ccccc2C(c2ccccc2)N1.Cl |
| InChI | InChI=1S/C21H25NO2S.ClH/c1-3-5-15-21(4-2)16-25(23,24)19-14-10-9-13-18(19)20(22-21)17-11-7-6-8-12-17;/h5-15,20,22H,3-4,16H2,1-2H3;1H |
| InChIKey | RRRMOELSVWYPLE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.96 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|