C20H21N5O4 — CID 67694729
[(11R,15S)-5-benzyl-8-methyl-7-oxo-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-4-yl] methyl carbonate (PubChem CID 67694729) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is [(11R,15S)-5-benzyl-8-methyl-7-oxo-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-4-yl] methyl carbonate.
| Compound Name | [(11R,15S)-5-benzyl-8-methyl-7-oxo-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-4-yl] methyl carbonate |
|---|---|
| PubChem CID | 67694729 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [(11R,15S)-5-benzyl-8-methyl-7-oxo-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-4-yl] methyl carbonate |
| SMILES | COC(=O)Oc1nc2c(n1Cc1ccccc1)C(=O)N(C)C1=N[C@@H]3CCC[C@@H]3N12 |
| InChI | InChI=1S/C20H21N5O4/c1-23-17(26)15-16(25-14-10-6-9-13(14)21-18(23)25)22-19(29-20(27)28-2)24(15)11-12-7-4-3-5-8-12/h3-5,7-8,13-14H,6,9-11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | ZFUXHPLVOOWZRI-KGLIPLIRSA-N |
| XLogP | 2.26 |
| TPSA | 89.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |