About 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one
3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one (PubChem CID 67695300) has the molecular formula C12H16N4O2
and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one |
| PubChem CID | 67695300 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one |
| SMILES | CCCc1ccc(=O)[nH]n1.Cc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C7H10N2O.C5H6N2O/c1-2-3-6-4-5-7(10)9-8-6;1-4-2-3-5(8)7-6-4/h4-5H,2-3H2,1H3,(H,9,10);2-3H,1H3,(H,7,8) |
| InChIKey | WAGZJBPPNRKFCH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one?
The IUPAC name of 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one (CID 67695300) is 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one.
What is the SMILES notation for 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one?
The canonical SMILES for 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one is CCCc1ccc(=O)[nH]n1.Cc1ccc(=O)[nH]n1.
What is the InChIKey of 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one?
The InChIKey is WAGZJBPPNRKFCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O.C5H6N2O/c1-2-3-6-4-5-7(10)9-8-6;1-4-2-3-5(8)7-6-4/h4-5H,2-3H2,1H3,(H,9,10);2-3H,1H3,(H,7,8).
What are the key properties of 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one?
3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one has a molecular weight of 248.29 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1H-pyridazin-6-one;3-propyl-1H-pyridazin-6-one is sourced from PubChem (CID 67695300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).