C21H34N4O2 — CID 67695448
[[(8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]-heptylamino]carbamic acid (PubChem CID 67695448) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is [[(8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]-heptylamino]carbamic acid.
| Compound Name | [[(8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]-heptylamino]carbamic acid |
|---|---|
| PubChem CID | 67695448 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | [[(8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl]-heptylamino]carbamic acid |
| SMILES | CCCCCCCN(NC(=O)O)c1ccc2c(c1)[C@]1(C)CCN(C)C1N2C |
| InChI | InChI=1S/C21H34N4O2/c1-5-6-7-8-9-13-25(22-20(26)27)16-10-11-18-17(15-16)21(2)12-14-23(3)19(21)24(18)4/h10-11,15,19,22H,5-9,12-14H2,1-4H3,(H,26,27)/t19?,21-/m0/s1 |
| InChIKey | JVVUNFRPHKKGOU-QWAKEFERSA-N |
| XLogP | 4.02 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|