About N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide
N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide (PubChem CID 67695654) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide |
| PubChem CID | 67695654 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide |
| SMILES | CC(=O)/N=c1\ccn(O)c(C)c1C |
| InChI | InChI=1S/C9H12N2O2/c1-6-7(2)11(13)5-4-9(6)10-8(3)12/h4-5,13H,1-3H3/b10-9+ |
| InChIKey | FIUAWVYQLJXMCD-MDZDMXLPSA-N |
| XLogP | 0.79 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide?
The IUPAC name of N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide (CID 67695654) is N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide.
What is the SMILES notation for N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide?
The canonical SMILES for N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide is CC(=O)/N=c1\ccn(O)c(C)c1C.
What is the InChIKey of N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide?
The InChIKey is FIUAWVYQLJXMCD-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-6-7(2)11(13)5-4-9(6)10-8(3)12/h4-5,13H,1-3H3/b10-9+.
What are the key properties of N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide?
N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide has a molecular weight of 180.21 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-2,3-dimethyl-4-pyridinylidene)acetamide is sourced from PubChem (CID 67695654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).