About 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid
3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid (PubChem CID 67695683) has the molecular formula C18H16N2O5S
and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid |
| PubChem CID | 67695683 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid |
| SMILES | NS(=O)(=O)c1ccccc1-c1onc(CCC(=O)O)c1-c1ccccc1 |
| InChI | InChI=1S/C18H16N2O5S/c19-26(23,24)15-9-5-4-8-13(15)18-17(12-6-2-1-3-7-12)14(20-25-18)10-11-16(21)22/h1-9H,10-11H2,(H,21,22)(H2,19,23,24) |
| InChIKey | FIZLZSAQSGETJS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid?
The IUPAC name of 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid (CID 67695683) is 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid.
What is the SMILES notation for 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid?
The canonical SMILES for 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid is NS(=O)(=O)c1ccccc1-c1onc(CCC(=O)O)c1-c1ccccc1.
What is the InChIKey of 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid?
The InChIKey is FIZLZSAQSGETJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5S/c19-26(23,24)15-9-5-4-8-13(15)18-17(12-6-2-1-3-7-12)14(20-25-18)10-11-16(21)22/h1-9H,10-11H2,(H,21,22)(H2,19,23,24).
What are the key properties of 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid?
3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid has a molecular weight of 372.40 g/mol, XLogP of 2.67, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-phenyl-5-(2-sulfamoylphenyl)-1,2-oxazol-3-yl]propanoic acid is sourced from PubChem (CID 67695683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).