About [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate
[1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate (PubChem CID 67695858) has the molecular formula C17H27BrN4O4
and a molecular weight of 431.33 g/mol. Its IUPAC name is [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate.
Molecular Properties
| Compound Name | [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate |
| PubChem CID | 67695858 |
| Molecular Formula | C17H27BrN4O4 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate |
| SMILES | CC(=O)OC(CBr)CCCCCCN1CN(C)c2c1n(C)c(=O)[nH]c2=O |
| InChI | InChI=1S/C17H27BrN4O4/c1-12(23)26-13(10-18)8-6-4-5-7-9-22-11-20(2)14-15(24)19-17(25)21(3)16(14)22/h13H,4-11H2,1-3H3,(H,19,24,25) |
| InChIKey | YYLYIJZSSMOGCS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate?
The IUPAC name of [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate (CID 67695858) is [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate.
What is the SMILES notation for [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate?
The canonical SMILES for [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate is CC(=O)OC(CBr)CCCCCCN1CN(C)c2c1n(C)c(=O)[nH]c2=O.
What is the InChIKey of [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate?
The InChIKey is YYLYIJZSSMOGCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27BrN4O4/c1-12(23)26-13(10-18)8-6-4-5-7-9-22-11-20(2)14-15(24)19-17(25)21(3)16(14)22/h13H,4-11H2,1-3H3,(H,19,24,25).
What are the key properties of [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate?
[1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate has a molecular weight of 431.33 g/mol, XLogP of 1.56, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-bromo-8-(3,7-dimethyl-2,6-dioxo-8H-purin-9-yl)octan-2-yl] acetate is sourced from PubChem (CID 67695858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).