About 3-chloro-5,6-dimethoxy-1,2-benzothiazole
3-chloro-5,6-dimethoxy-1,2-benzothiazole (PubChem CID 67696171) has the molecular formula C9H8ClNO2S
and a molecular weight of 229.69 g/mol. Its IUPAC name is 3-chloro-5,6-dimethoxy-1,2-benzothiazole.
Molecular Properties
| Compound Name | 3-chloro-5,6-dimethoxy-1,2-benzothiazole |
| PubChem CID | 67696171 |
| Molecular Formula | C9H8ClNO2S |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 3-chloro-5,6-dimethoxy-1,2-benzothiazole |
| SMILES | COc1cc2snc(Cl)c2cc1OC |
| InChI | InChI=1S/C9H8ClNO2S/c1-12-6-3-5-8(4-7(6)13-2)14-11-9(5)10/h3-4H,1-2H3 |
| InChIKey | JJLCVRZDKDAIGW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-5,6-dimethoxy-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,6-dimethoxy-1,2-benzothiazole?
The IUPAC name of 3-chloro-5,6-dimethoxy-1,2-benzothiazole (CID 67696171) is 3-chloro-5,6-dimethoxy-1,2-benzothiazole.
What is the SMILES notation for 3-chloro-5,6-dimethoxy-1,2-benzothiazole?
The canonical SMILES for 3-chloro-5,6-dimethoxy-1,2-benzothiazole is COc1cc2snc(Cl)c2cc1OC.
What is the InChIKey of 3-chloro-5,6-dimethoxy-1,2-benzothiazole?
The InChIKey is JJLCVRZDKDAIGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO2S/c1-12-6-3-5-8(4-7(6)13-2)14-11-9(5)10/h3-4H,1-2H3.
What are the key properties of 3-chloro-5,6-dimethoxy-1,2-benzothiazole?
3-chloro-5,6-dimethoxy-1,2-benzothiazole has a molecular weight of 229.69 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,6-dimethoxy-1,2-benzothiazole is sourced from PubChem (CID 67696171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).