About 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one
7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one (PubChem CID 67696324) has the molecular formula C15H14FN5OS
and a molecular weight of 331.38 g/mol. Its IUPAC name is 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one |
| PubChem CID | 67696324 |
| Molecular Formula | C15H14FN5OS |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one |
| SMILES | NC1CN(c2ccc3c(=O)ccn(-c4nccs4)c3n2)CC1F |
| InChI | InChI=1S/C15H14FN5OS/c16-10-7-20(8-11(10)17)13-2-1-9-12(22)3-5-21(14(9)19-13)15-18-4-6-23-15/h1-6,10-11H,7-8,17H2 |
| InChIKey | PDQJTRFGSQBWIV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one?
The IUPAC name of 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one (CID 67696324) is 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one.
What is the SMILES notation for 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one?
The canonical SMILES for 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one is NC1CN(c2ccc3c(=O)ccn(-c4nccs4)c3n2)CC1F.
What is the InChIKey of 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one?
The InChIKey is PDQJTRFGSQBWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FN5OS/c16-10-7-20(8-11(10)17)13-2-1-9-12(22)3-5-21(14(9)19-13)15-18-4-6-23-15/h1-6,10-11H,7-8,17H2.
What are the key properties of 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one?
7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one has a molecular weight of 331.38 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-amino-4-fluoropyrrolidin-1-yl)-1-(1,3-thiazol-2-yl)-1,8-naphthyridin-4-one is sourced from PubChem (CID 67696324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).