C30H54O3Si — CID 67696697
[(2R,4R)-2-[2-[(1S,2R,8S,8aR)-2-methyl-8-[(2S)-2-methylpentoxy]-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 67696697) has the molecular formula C30H54O3Si and a molecular weight of 490.85 g/mol. Its IUPAC name is [(2R,4R)-2-[2-[(1S,2R,8S,8aR)-2-methyl-8-[(2S)-2-methylpentoxy]-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4R)-2-[2-[(1S,2R,8S,8aR)-2-methyl-8-[(2S)-2-methylpentoxy]-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 67696697 |
| Molecular Formula | C30H54O3Si |
| Molecular Weight | 490.85 g/mol |
| Exact Mass | 490.38 |
| IUPAC Name | [(2R,4R)-2-[2-[(1S,2R,8S,8aR)-2-methyl-8-[(2S)-2-methylpentoxy]-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]oxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCC[C@H](C)CO[C@H]1CCC=C2C=C[C@@H](C)[C@H](CC[C@@H]3C[C@H](O[Si](C)(C)C(C)(C)C)CCO3)[C@H]21 |
| InChI | InChI=1S/C30H54O3Si/c1-9-11-22(2)21-32-28-13-10-12-24-15-14-23(3)27(29(24)28)17-16-25-20-26(18-19-31-25)33-34(7,8)30(4,5)6/h12,14-15,22-23,25-29H,9-11,13,16-21H2,1-8H3/t22-,23+,25+,26+,27-,28-,29-/m0/s1 |
| InChIKey | CJVQMUMVYJTKEA-APCISXJISA-N |
| XLogP | 8.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.85 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|