C14H17N3O — CID 67697104
2-(2,4,6-trimethylphenoxy)pyridine-3,4-diamine (PubChem CID 67697104) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenoxy)pyridine-3,4-diamine.
| Compound Name | 2-(2,4,6-trimethylphenoxy)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 67697104 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-(2,4,6-trimethylphenoxy)pyridine-3,4-diamine |
| SMILES | Cc1cc(C)c(Oc2nccc(N)c2N)c(C)c1 |
| InChI | InChI=1S/C14H17N3O/c1-8-6-9(2)13(10(3)7-8)18-14-12(16)11(15)4-5-17-14/h4-7H,16H2,1-3H3,(H2,15,17) |
| InChIKey | SASFZCKPMWOKLW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |