C24H27F2NO2 — CID 67697281
(3,4-difluorophenyl)-[1-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]piperidin-4-yl]methanone (PubChem CID 67697281) has the molecular formula C24H27F2NO2 and a molecular weight of 399.48 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[1-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]piperidin-4-yl]methanone.
| Compound Name | (3,4-difluorophenyl)-[1-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 67697281 |
| Molecular Formula | C24H27F2NO2 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (3,4-difluorophenyl)-[1-[3-(2,3-dihydro-1H-inden-4-yloxy)propyl]piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)C1CCN(CCCOc2cccc3c2CCC3)CC1 |
| InChI | InChI=1S/C24H27F2NO2/c25-21-9-8-19(16-22(21)26)24(28)18-10-13-27(14-11-18)12-3-15-29-23-7-2-5-17-4-1-6-20(17)23/h2,5,7-9,16,18H,1,3-4,6,10-15H2 |
| InChIKey | BEFYXAGKGLWMSL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|