C12H23NO2 — CID 67698310
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;1-nitroethane (PubChem CID 67698310) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;1-nitroethane.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;1-nitroethane |
|---|---|
| PubChem CID | 67698310 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;1-nitroethane |
| SMILES | C1CCC2CCCCC2C1.CC[N+](=O)[O-] |
| InChI | InChI=1S/C10H18.C2H5NO2/c1-2-6-10-8-4-3-7-9(10)5-1;1-2-3(4)5/h9-10H,1-8H2;2H2,1H3 |
| InChIKey | WSEMXLKDLAHJED-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|