C29H28N2O2 — CID 67698632
[6-[2-(4,5-diphenylimidazol-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate (PubChem CID 67698632) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is [6-[2-(4,5-diphenylimidazol-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate.
| Compound Name | [6-[2-(4,5-diphenylimidazol-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 67698632 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [6-[2-(4,5-diphenylimidazol-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1CCC(CCn1cnc(-c3ccccc3)c1-c1ccccc1)C2 |
| InChI | InChI=1S/C29H28N2O2/c1-21(32)33-27-14-8-13-25-19-22(15-16-26(25)27)17-18-31-20-30-28(23-9-4-2-5-10-23)29(31)24-11-6-3-7-12-24/h2-14,20,22H,15-19H2,1H3 |
| InChIKey | RUJHWIOKLLQSMK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|