About 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine
3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine (PubChem CID 67698777) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine.
Analyze 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine?
The IUPAC name of 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine (CID 67698777) is 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine.
What is the SMILES notation for 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine?
The canonical SMILES for 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine is NCC1=CC2CN=CCC2O1.
What is the InChIKey of 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine?
The InChIKey is FWVNIKAHSNSQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-4-7-3-6-5-10-2-1-8(6)11-7/h2-3,6,8H,1,4-5,9H2.
What are the key properties of 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine?
3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine has a molecular weight of 152.20 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4,7,7a-tetrahydrofuro[3,2-c]pyridin-2-ylmethanamine is sourced from PubChem (CID 67698777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).