C6H11NO4 — CID 67699212
(1R,2S,3S,4R,5R)-3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol (PubChem CID 67699212) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R)-3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol.
| Compound Name | (1R,2S,3S,4R,5R)-3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol |
|---|---|
| PubChem CID | 67699212 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | (1R,2S,3S,4R,5R)-3-amino-6,8-dioxabicyclo[3.2.1]octane-2,4-diol |
| SMILES | N[C@@H]1[C@@H](O)[C@@H]2OC[C@@H](O2)[C@H]1O |
| InChI | InChI=1S/C6H11NO4/c7-3-4(8)2-1-10-6(11-2)5(3)9/h2-6,8-9H,1,7H2/t2-,3+,4-,5-,6-/m1/s1 |
| InChIKey | PWSKXRKZLJHEKE-AIECOIEWSA-N |
| XLogP | -2.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |