C23H40ClN — CID 67699429
[(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl-trimethylazanium chloride (PubChem CID 67699429) has the molecular formula C23H40ClN and a molecular weight of 366.03 g/mol. Its IUPAC name is [(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl-trimethylazanium chloride.
| Compound Name | [(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 67699429 |
| Molecular Formula | C23H40ClN |
| Molecular Weight | 366.03 g/mol |
| Exact Mass | 365.28 |
| IUPAC Name | [(1S,4aR,4bS)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthren-1-yl]methyl-trimethylazanium chloride |
| SMILES | CC(C)C1=CC2=CCC3[C@@](C)(C[N+](C)(C)C)CCC[C@]3(C)[C@@H]2CC1.[Cl-] |
| InChI | InChI=1S/C23H40N.ClH/c1-17(2)18-9-11-20-19(15-18)10-12-21-22(3,16-24(5,6)7)13-8-14-23(20,21)4;/h10,15,17,20-21H,8-9,11-14,16H2,1-7H3;1H/q+1;/p-1/t20-,21?,22-,23-;/m1./s1 |
| InChIKey | DTOPQXDSIFOQGP-QWHWTUCSSA-M |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.03 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|