C27H28FN3O7 — CID 67699562
(9S)-N-[[(2R,3R,4R,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl]-4-methoxy-N-methyl-9H-xanthene-9-carboxamide (PubChem CID 67699562) has the molecular formula C27H28FN3O7 and a molecular weight of 525.53 g/mol. Its IUPAC name is (9S)-N-[[(2R,3R,4R,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl]-4-methoxy-N-methyl-9H-xanthene-9-carboxamide.
| Compound Name | (9S)-N-[[(2R,3R,4R,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl]-4-methoxy-N-methyl-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 67699562 |
| Molecular Formula | C27H28FN3O7 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | (9S)-N-[[(2R,3R,4R,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl]-4-methoxy-N-methyl-9H-xanthene-9-carboxamide |
| SMILES | CCc1cn([C@@H]2O[C@H](CN(C)C(=O)[C@H]3c4ccccc4Oc4c(OC)cccc43)[C@@H](O)[C@H]2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H28FN3O7/c1-4-14-12-31(27(35)29-24(14)33)26-21(28)22(32)19(38-26)13-30(2)25(34)20-15-8-5-6-10-17(15)37-23-16(20)9-7-11-18(23)36-3/h5-12,19-22,26,32H,4,13H2,1-3H3,(H,29,33,35)/t19-,20+,21-,22-,26-/m1/s1 |
| InChIKey | APMFEKOHMYUYDF-DCYXXNAWSA-N |
| XLogP | 2.10 |
| TPSA | 123.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |