C28H28FN3O5S — CID 67700170
N-[[(2R,3R,4R,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-3-prop-2-enyloxolan-2-yl]methyl]-9H-thioxanthene-9-carboxamide (PubChem CID 67700170) has the molecular formula C28H28FN3O5S and a molecular weight of 537.61 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-3-prop-2-enyloxolan-2-yl]methyl]-9H-thioxanthene-9-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-3-prop-2-enyloxolan-2-yl]methyl]-9H-thioxanthene-9-carboxamide |
|---|---|
| PubChem CID | 67700170 |
| Molecular Formula | C28H28FN3O5S |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | N-[[(2R,3R,4R,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-3-prop-2-enyloxolan-2-yl]methyl]-9H-thioxanthene-9-carboxamide |
| SMILES | C=CC[C@@]1(O)[C@@H](CNC(=O)C2c3ccccc3Sc3ccccc32)O[C@@H](n2cc(CC)c(=O)[nH]c2=O)[C@@H]1F |
| InChI | InChI=1S/C28H28FN3O5S/c1-3-13-28(36)21(37-26(23(28)29)32-15-16(4-2)24(33)31-27(32)35)14-30-25(34)22-17-9-5-7-11-19(17)38-20-12-8-6-10-18(20)22/h3,5-12,15,21-23,26,36H,1,4,13-14H2,2H3,(H,30,34)(H,31,33,35)/t21-,23+,26-,28-/m1/s1 |
| InChIKey | BLOQAYOQJIRYJB-PKZARACNSA-N |
| XLogP | 3.05 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|