C13H19N5 — CID 67700695
2,3,4,5,6-pentazabicyclo[12.3.1]octadeca-1,3,5,7,9-pentaene (PubChem CID 67700695) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 2,3,4,5,6-pentazabicyclo[12.3.1]octadeca-1,3,5,7,9-pentaene.
| Compound Name | 2,3,4,5,6-pentazabicyclo[12.3.1]octadeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 67700695 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 2,3,4,5,6-pentazabicyclo[12.3.1]octadeca-1,3,5,7,9-pentaene |
| SMILES | C1=CCCCC2CCCC(=NN=N/N=N\C=C1)C2 |
| InChI | InChI=1S/C13H19N5/c1-2-4-7-12-8-6-9-13(11-12)15-17-18-16-14-10-5-3-1/h1,3,5,10,12H,2,4,6-9,11H2/b3-1?,10-5?,15-13?,16-14-,18-17? |
| InChIKey | WUKHFITWVAAEFR-WUHAMPPTSA-N |
| XLogP | 4.61 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |