C19H20Cl2NO7P — CID 67700829
2-[2,3-dichloro-6-(5-cyclopropyl-3-ethoxycarbonyl-1,2-oxazole-4-carbonyl)phenyl]propan-2-ylphosphonic acid (PubChem CID 67700829) has the molecular formula C19H20Cl2NO7P and a molecular weight of 476.25 g/mol. Its IUPAC name is 2-[2,3-dichloro-6-(5-cyclopropyl-3-ethoxycarbonyl-1,2-oxazole-4-carbonyl)phenyl]propan-2-ylphosphonic acid.
| Compound Name | 2-[2,3-dichloro-6-(5-cyclopropyl-3-ethoxycarbonyl-1,2-oxazole-4-carbonyl)phenyl]propan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 67700829 |
| Molecular Formula | C19H20Cl2NO7P |
| Molecular Weight | 476.25 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | 2-[2,3-dichloro-6-(5-cyclopropyl-3-ethoxycarbonyl-1,2-oxazole-4-carbonyl)phenyl]propan-2-ylphosphonic acid |
| SMILES | CCOC(=O)c1noc(C2CC2)c1C(=O)c1ccc(Cl)c(Cl)c1C(C)(C)P(=O)(O)O |
| InChI | InChI=1S/C19H20Cl2NO7P/c1-4-28-18(24)15-12(17(29-22-15)9-5-6-9)16(23)10-7-8-11(20)14(21)13(10)19(2,3)30(25,26)27/h7-9H,4-6H2,1-3H3,(H2,25,26,27) |
| InChIKey | BNJWAEAKZXZASP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|