C34H45NO6 — CID 67700896
6-methoxy-6-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]hexan-1-amine (PubChem CID 67700896) has the molecular formula C34H45NO6 and a molecular weight of 563.74 g/mol. Its IUPAC name is 6-methoxy-6-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]hexan-1-amine.
| Compound Name | 6-methoxy-6-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]hexan-1-amine |
|---|---|
| PubChem CID | 67700896 |
| Molecular Formula | C34H45NO6 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | 6-methoxy-6-[(2R,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]hexan-1-amine |
| SMILES | COC(CCCCCN)[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H45NO6/c1-36-29(21-13-6-14-22-35)30-31(38-23-26-15-7-3-8-16-26)32(39-24-27-17-9-4-10-18-27)33(34(37-2)41-30)40-25-28-19-11-5-12-20-28/h3-5,7-12,15-20,29-34H,6,13-14,21-25,35H2,1-2H3/t29?,30-,31-,32+,33-,34+/m1/s1 |
| InChIKey | ZFTYKFLVAFHMAO-FHRXWVBDSA-N |
| XLogP | 5.65 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|