About 4-methoxy-2,2-dimethylfuran-3-one
4-methoxy-2,2-dimethylfuran-3-one (PubChem CID 67700961) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 4-methoxy-2,2-dimethylfuran-3-one.
Molecular Properties
| Compound Name | 4-methoxy-2,2-dimethylfuran-3-one |
| PubChem CID | 67700961 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 4-methoxy-2,2-dimethylfuran-3-one |
| SMILES | COC1=COC(C)(C)C1=O |
| InChI | InChI=1S/C7H10O3/c1-7(2)6(8)5(9-3)4-10-7/h4H,1-3H3 |
| InChIKey | LCYKOEKYZHRGIQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-2,2-dimethylfuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,2-dimethylfuran-3-one?
The IUPAC name of 4-methoxy-2,2-dimethylfuran-3-one (CID 67700961) is 4-methoxy-2,2-dimethylfuran-3-one.
What is the SMILES notation for 4-methoxy-2,2-dimethylfuran-3-one?
The canonical SMILES for 4-methoxy-2,2-dimethylfuran-3-one is COC1=COC(C)(C)C1=O.
What is the InChIKey of 4-methoxy-2,2-dimethylfuran-3-one?
The InChIKey is LCYKOEKYZHRGIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-7(2)6(8)5(9-3)4-10-7/h4H,1-3H3.
What are the key properties of 4-methoxy-2,2-dimethylfuran-3-one?
4-methoxy-2,2-dimethylfuran-3-one has a molecular weight of 142.15 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,2-dimethylfuran-3-one is sourced from PubChem (CID 67700961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).