C21H24Cl2N2O2 — CID 67701046
9-[(2-chloro-3,4-dimethoxyphenyl)methyl]-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole;hydrochloride (PubChem CID 67701046) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is 9-[(2-chloro-3,4-dimethoxyphenyl)methyl]-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole;hydrochloride.
| Compound Name | 9-[(2-chloro-3,4-dimethoxyphenyl)methyl]-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 67701046 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 9-[(2-chloro-3,4-dimethoxyphenyl)methyl]-6-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole;hydrochloride |
| SMILES | COc1ccc(Cn2c3c(c4cc(C)ccc42)CCNC3)c(Cl)c1OC.Cl |
| InChI | InChI=1S/C21H23ClN2O2.ClH/c1-13-4-6-17-16(10-13)15-8-9-23-11-18(15)24(17)12-14-5-7-19(25-2)21(26-3)20(14)22;/h4-7,10,23H,8-9,11-12H2,1-3H3;1H |
| InChIKey | ICQXXEOCACNZGL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|